Sell. 2-amino-3-(trifluoromethoxy)benzoic acid2018-08-29 |
Molecular formula:C8H6F3NO3 Molecular weight: |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 2-amino-4-bromophenol2018-08-29 |
Molecular formula:C6H6BrNO Molecular weight:188.02 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 4-bromo-2-nitrophenol2018-08-29 |
Molecular formula:C6H4BrNO3 Molecular weight:218 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 2,4,5-trichlorobenzoic acid2018-08-29 |
Molecular formula:C7H3Cl3O2 Molecular weight:225.46 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. Potassium 4-nitrophenyl sulfate2018-08-29 |
Molecular formula:C6H4KNO6S Molecular weight:257.26 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 4-amino-5-chloro-2-ethoxybenzoic acid2018-08-29 |
Molecular formula:C9H10ClNO3 Molecular weight:215.64 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 4-amino-5-bromo-2-methoxybenzoic acid2018-08-29 |
Molecular formula:C8H8BrNO3 Molecular weight:246.06 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 4-amino-5-chloro-2-methoxybenzoic acid2018-08-29 |
Molecular formula:C8H8ClNO3 Molecular weight:201.61 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 2-amino-3-nitrobenzoic acid2018-08-29 |
Molecular formula:C7H6N2O4 Molecular weight:182.13 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 2,3-diaminobenzoic acid2018-08-29 |
Molecular formula:C7H8N2O2 Molecular weight:152.15 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. N-(2-nitrophenyl)phosphoric triamide2018-08-29 |
|
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 2-hydroxy-4隆爐-iodoacetophenone2018-08-29 |
Molecular formula:C8H7IO2 Molecular weight:262.04 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. benzyl anthranilate2018-08-29 |
Molecular formula: Molecular weight: |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 4-tritylaniline2018-08-29 |
Molecular formula:C25H21N Molecular weight:335.44 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 3,5-Dibromobenzonitrile2018-08-29 |
Molecular formula:C7H3Br2N Molecular weight:260.91 |
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. 3-(4-Methoxyphenyl)propionaldehyde2018-08-29 |
|
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. Ethyl isopropyl sulfone2018-08-29 |
|
Company: Nanjing qite chemical technology co.,ltd. [Tel:0086-25-58371813] |
|
Sell. Yuxing Fine Magnesium Hydroxide2018-08-28 |
Magnesium Hydroxide Mg(OH)2
Yuxing Fire-retardant New Materials Co.,Ltd is manufacturing, exporting and sup |
Company: Guangdong yuxing fire-retardant new materials co.,ltd. [Tel:020-87591179] |
|
Sell. Yuxing Antimony Trioxide Powder 99.5% Min2018-08-28 |
Guangdong Yuxing Fire-retardant New Materials Co. Ltd. is professional manufacturer of flame retardant produ |
Company: Guangdong yuxing fire-retardant new materials co.,ltd. [Tel:86-20-87591179] |
|
Sell. Yuxing Antimony Trioxide Powder 99.8% Min2018-08-28 |
Guangdong Yuxing Fire-retardant New Materials Co. Ltd. is professional manufacturer of flame retardant produ |
Company: Guangdong yuxing fire-retardant new materials co.,ltd. [Tel:86-20-87591179] |
|